
CAS 728024-60-0
:1-Ethyl-2,3-dimethyl-4-piperidinone
Description:
1-Ethyl-2,3-dimethyl-4-piperidinone, with the CAS number 728024-60-0, is a cyclic amine characterized by a piperidinone structure, which includes a six-membered ring containing nitrogen. This compound features an ethyl group and two methyl groups attached to the piperidine ring, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid with a distinctive odor. The presence of the carbonyl group (ketone) in the piperidinone structure imparts reactivity, making it useful in various chemical syntheses and applications. The compound is soluble in organic solvents, which enhances its utility in organic chemistry. Additionally, it may exhibit biological activity, making it of interest in pharmaceutical research. Safety data should be consulted for handling and exposure, as with any chemical substance, to ensure proper precautions are taken. Overall, 1-Ethyl-2,3-dimethyl-4-piperidinone is a versatile compound with potential applications in both industrial and research settings.
Formula:C9H17NO
InChI:InChI=1S/C9H17NO/c1-4-10-6-5-9(11)7(2)8(10)3/h7-8H,4-6H2,1-3H3
InChI key:InChIKey=RRUBGQWCJKNSGN-UHFFFAOYSA-N
SMILES:C(C)N1C(C)C(C)C(=O)CC1
Synonyms:- 4-Piperidinone, 1-ethyl-2,3-dimethyl-
- 1-Ethyl-2,3-dimethyl-4-piperidinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.