CAS 728035-62-9

5-[(4,5-dimethyl-4H-1,2,4-triazol-3-yl)sulfanyl]furan-2-carbaldehyde

Description:

5-[(4,5-dimethyl-4H-1,2,4-triazol-3-yl)sulfanyl]furan-2-carbaldehyde is a chemical compound characterized by its unique structure, which includes a furan ring and a triazole moiety. The presence of a sulfanyl group introduces a thiol functionality, enhancing its reactivity and potential applications in various chemical reactions. This compound typically exhibits properties associated with both heterocyclic compounds and aldehydes, such as being a potential electrophile due to the carbonyl group. Its molecular structure suggests it may participate in diverse chemical interactions, including nucleophilic attacks and condensation reactions. The dimethyl substitution on the triazole ring can influence its solubility and stability, making it of interest in medicinal chemistry and material science. Additionally, compounds with similar structures have been studied for their biological activities, including antimicrobial and antifungal properties. Overall, 5-[(4,5-dimethyl-4H-1,2,4-triazol-3-yl)sulfanyl]furan-2-carbaldehyde represents a versatile scaffold for further chemical exploration and potential therapeutic applications.

Formula: C₉H₉N₃O₂S

InChI: InChI=1/C9H9N3O2S/c1-6-10-11-9(12(6)2)15-8-4-3-7(5-13)14-8/h3-5H,1-2H3

SMILES: Cc1nnc(n1C)Sc1ccc(C=O)o1

Synonyms:

• 2-furancarboxaldehyde, 5-[(4,5-dimethyl-4H-1,2,4-triazol-3-yl)thio]-
• 5-[(4,5-Dimethyl-4H-1,2,4-triazol-3-yl)sulfanyl]-2-furaldehyde

5-[(4,5-Dimethyl-4H-1,2,4-triazol-3-yl)thio]-2-furaldehyde

CAS: 728035-62-9

Formula: C₉H₉N₃O₂S

Molecular weight: 223.2517

Ref: IN-DA005P0O

5-[(4,5-Dimethyl-4H-1,2,4-triazol-3-yl)thio]-2-furaldehyde

CAS: 728035-62-9

5-[(4,5-Dimethyl-4H-1,2,4-triazol-3-yl)thio]-2-furaldehyde is a versatile building block that can be used as a research chemical or reagent. It is also useful for the synthesis of complex compounds. This material has been shown to be an excellent starting point for the synthesis of high quality and useful scaffolds.

Formula: C₉H₉N₃O₂S

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 223.25 g/mol

Ref: 3D-FD120211