CymitQuimica logo

CAS 72810-60-7

:

3-(Aminosulfonyl)-4-pyridinesulfonic acid

Description:
3-(Aminosulfonyl)-4-pyridinesulfonic acid, with the CAS number 72810-60-7, is a sulfonic acid derivative of pyridine that features both amino and sulfonyl functional groups. This compound is characterized by its strong acidity due to the presence of sulfonic acid groups, which can donate protons in solution. It is typically a white to off-white solid and is soluble in water, making it useful in various aqueous applications. The presence of the amino group allows for potential interactions with biological systems, which may contribute to its utility in pharmaceutical and biochemical research. Additionally, the compound may exhibit properties such as chelation and complexation with metal ions, which can be advantageous in catalysis or as a reagent in organic synthesis. Its structural features suggest that it may participate in hydrogen bonding, influencing its solubility and reactivity. Overall, 3-(Aminosulfonyl)-4-pyridinesulfonic acid is a versatile compound with applications in both research and industry, particularly in areas requiring strong acids or specific functional group interactions.
Formula:C5H6N2O5S2
InChI:InChI=1/C5H6N2O5S2/c6-13(8,9)5-3-7-2-1-4(5)14(10,11)12/h1-3H,(H2,6,8,9)(H,10,11,12)
SMILES:c1cncc(c1S(=O)(=O)O)S(=O)(=O)N
Synonyms:
  • 3-Sulfamoylpyridine-4-Sulfonic Acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.