CAS 72814-32-5
:rel-(4R)-3-[(3S)-3-Cyclohexyl-3-hydroxypropyl]-2,5-dioxo-4-imidazolidineheptanoic acid
Description:
The chemical substance known as rel-(4R)-3-[(3S)-3-Cyclohexyl-3-hydroxypropyl]-2,5-dioxo-4-imidazolidineheptanoic acid, with the CAS number 72814-32-5, is a complex organic compound characterized by its imidazolidine ring structure, which contributes to its unique chemical properties. This compound features multiple functional groups, including a dioxo moiety and a hydroxypropyl side chain, which enhance its potential for biological activity. The presence of the cyclohexyl group adds to its hydrophobic characteristics, influencing its solubility and interaction with biological membranes. The stereochemistry indicated by the rel- and R/S designations suggests specific spatial arrangements of atoms, which can significantly affect the compound's reactivity and interactions with biological targets. Such compounds are often studied for their potential therapeutic applications, particularly in the fields of medicinal chemistry and drug design, due to their ability to mimic natural biological molecules. Understanding the characteristics of this compound can provide insights into its potential uses and mechanisms of action in various biochemical contexts.
Formula:C19H32N2O5
InChI:InChI=1/C19H32N2O5/c22-16(14-8-4-3-5-9-14)12-13-21-15(18(25)20-19(21)26)10-6-1-2-7-11-17(23)24/h14-16,22H,1-13H2,(H,23,24)(H,20,25,26)/t15-,16+/s2
InChI key:InChIKey=ZIDQIOZJEJFMOH-REIYMHPCNA-N
SMILES:C(C[C@@H](O)C1CCCCC1)N2[C@@H](CCCCCCC(O)=O)C(=O)NC2=O
Synonyms:- 4-Imidazolidineheptanoic acid, 3-(3-cyclohexyl-3-hydroxypropyl)-2,5-dioxo-, (R*,S*)-
- 4-Imidazolidineheptanoic acid, 3-[(3R)-3-cyclohexyl-3-hydroxypropyl]-2,5-dioxo-, (4S)-rel-
- 4-Imidazolidineheptanoic acid, 3-[(3S)-3-cyclohexyl-3-hydroxypropyl]-2,5-dioxo-, (4R)-rel-
- 4-imidazolidineheptanoic acid, 3-[(3R)-3-cyclohexyl-3-hydroxypropyl]-2,5-dioxo-, (4S)-
- Bw 245C
- rel-(4R)-3-[(3S)-3-Cyclohexyl-3-hydroxypropyl]-2,5-dioxo-4-imidazolidineheptanoic acid
- 7-{(4S)-3-[(3R)-3-Cyclohexyl-3-hydroxypropyl]-2,5-dioxoimidazolidin-4-yl}heptanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
BW 245C
CAS:BW 245C is a synthetic compound that functions as an herbicide. It is derived from chemical synthesis specifically designed to target and manage the growth of unwanted plants. The mode of action of BW 245C involves the disruption of essential physiological processes within plants, often targeting enzymatic pathways crucial for growth and photosynthesis. This disruption leads to inhibited growth or plant death, making it effective in controlling a broad spectrum of weed species.
Formula:C19H32N2O5Purity:Min. 95%Molecular weight:368.47 g/molBW 245C
CAS:BW 245C is a DP1 agonist with an inhibitory effect on the aggregation response of collagen and can be used to study diseases such as stroke.Formula:C19H32N2O5Purity:≥99%Color and Shape:SolidMolecular weight:368.47




