CymitQuimica logo

CAS 72814-84-7

:

erythrosin B isothiocyanate

Description:
Erythrosin B isothiocyanate is a synthetic organic compound characterized by its vibrant pink color, which is derived from the erythrosin dye. It is primarily used in biological and chemical research, particularly in the study of proteins and nucleic acids due to its ability to bind to various biomolecules. The compound features an isothiocyanate functional group, which enhances its reactivity and allows for the formation of covalent bonds with amino acids, particularly cysteine and lysine residues in proteins. This property makes it valuable in labeling and detection applications. Erythrosin B isothiocyanate is soluble in polar solvents, such as water and alcohol, and exhibits fluorescence, making it useful in fluorescence microscopy and flow cytometry. However, like many synthetic dyes, it should be handled with care due to potential toxicity and environmental concerns. Overall, its unique chemical structure and properties make it a versatile tool in biochemical research and diagnostics.
Formula:C21H7I4NO5S
InChI:InChI=1/C21H7I4NO5S/c22-12-4-10-18(14(24)16(12)27)30-19-11(5-13(23)17(28)15(19)25)21(10)9-3-7(26-6-32)1-2-8(9)20(29)31-21/h1-5,27-28H
SMILES:c1cc2c(cc1N=C=S)C1(c3cc(c(c(c3Oc3c1cc(c(c3I)O)I)I)O)I)OC2=O
Synonyms:
  • Erythrosin B isothiocyanate,isomer II
  • EITC Erythrosin Isothiocyanate
  • 3',6'-dihydroxy-2',4',5',7'-tetraiodo-6-isothiocyanato-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.