
CAS 72816-80-9
:1-Tetradecyl-1H-benzimidazole
Description:
1-Tetradecyl-1H-benzimidazole is an organic compound characterized by its long hydrophobic tetradecyl chain and a benzimidazole moiety, which contributes to its unique chemical properties. This compound typically exhibits amphiphilic behavior, making it useful in various applications, including as a surfactant or in drug delivery systems. The presence of the benzimidazole ring provides potential biological activity, as benzimidazole derivatives are known for their roles in pharmaceuticals, particularly as antifungal and antiparasitic agents. The tetradecyl chain enhances its solubility in non-polar solvents while maintaining some degree of solubility in polar environments, which is advantageous for formulations requiring emulsification or stabilization. Additionally, 1-Tetradecyl-1H-benzimidazole may exhibit thermal stability and resistance to degradation, making it suitable for use in diverse chemical environments. Its molecular structure allows for potential interactions with biological membranes, which can be explored in medicinal chemistry and material science. Overall, this compound's unique characteristics make it a subject of interest in both industrial and research applications.
Formula:C21H34N2
InChI:InChI=1S/C21H34N2/c1-2-3-4-5-6-7-8-9-10-11-12-15-18-23-19-22-20-16-13-14-17-21(20)23/h13-14,16-17,19H,2-12,15,18H2,1H3
InChI key:InChIKey=QPHHOADAIHHOMT-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCCCC)N1C=2C(N=C1)=CC=CC2
Synonyms:- 1-Tetradecyl-1H-benzoimidazole
- 1H-Benzimidazole, 1-tetradecyl-
- 1-Tetradecyl-1H-benzimidazole
- 1-Tetradecyl-1H-benzo[d]imidazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.