CAS 72821-91-1

(8beta)-8-[(methylsulfanyl)methyl]ergoline

Description:

(8beta)-8-[(methylsulfanyl)methyl]ergoline, identified by its CAS number 72821-91-1, is a chemical compound belonging to the ergoline family, which is characterized by a tetracyclic structure derived from lysergic acid. This compound features a methylsulfanyl group attached to the 8-position of the ergoline skeleton, which can influence its biological activity and solubility. Ergoline derivatives are known for their diverse pharmacological properties, including effects on serotonin receptors, which may contribute to their psychoactive effects. The presence of the methylsulfanyl group may enhance lipophilicity, potentially affecting the compound's interaction with biological membranes and its overall pharmacokinetics. As with many ergoline derivatives, the specific characteristics such as melting point, solubility, and stability can vary based on the molecular structure and substituents. Research into this compound may focus on its potential therapeutic applications, safety profile, and mechanisms of action, particularly in relation to neurological or psychiatric conditions.

Formula: C₁₆H₂₀N₂S

InChI: InChI=1/C16H20N2S/c1-19-9-10-5-13-12-3-2-4-14-16(12)11(8-18-14)6-15(13)17-7-10/h2-4,8,10,13,15,17-18H,5-7,9H2,1H3/t10-,13-,15-/m1/s1

SMILES: CSC[C@@H]1C[C@@H]2c3cccc4c3c(C[C@H]2NC1)c[nH]4

Pergolide Impurity 12

CAS: 72821-91-1

Formula: C₁₆H₂₀N₂S

Molecular weight: 272.41

Ref: 4Z-P-436016

N-Despropyl Pergolide

Controlled Product

CAS: 72821-91-1

Formula: C₁₆H₂₀N₂S

Color and Shape: Neat

Molecular weight: 272.41

Ref: TR-D297310