CAS 72822-01-6
:Pergolide sulfoxide
Description:
Pergolide sulfoxide is a chemical compound that is a derivative of pergolide, which is primarily known for its use in the treatment of Parkinson's disease. As a sulfoxide, it contains a sulfur atom bonded to an oxygen atom, which contributes to its unique chemical properties. Pergolide sulfoxide is characterized by its ability to interact with dopamine receptors, similar to its parent compound, thereby influencing neurotransmitter activity in the brain. This compound typically appears as a solid at room temperature and is soluble in organic solvents. Its molecular structure includes various functional groups that enhance its pharmacological activity. The compound is of interest in medicinal chemistry due to its potential therapeutic effects, but it may also exhibit side effects typical of dopaminergic agents. As with many pharmaceuticals, the safety profile and efficacy of pergolide sulfoxide are subjects of ongoing research, particularly regarding its long-term use and interactions with other medications.
Formula:C19H26N2OS
InChI:InChI=1S/C19H26N2OS/c1-3-7-21-11-13(12-23(2)22)8-16-15-5-4-6-17-19(15)14(10-20-17)9-18(16)21/h4-6,10,13,16,18,20H,3,7-9,11-12H2,1-2H3/t13-,16-,18-,23?/m1/s1
InChI key:InChIKey=WOIHSNDTPKFAJW-LNWQLOGCSA-N
SMILES:C(CC)N1[C@]2([C@@](C=3C=4C(C2)=CNC4C=CC3)(C[C@@H](CS(C)=O)C1)[H])[H]
Synonyms:- Ergoline, 8-[(methylsulfinyl)methyl]-6-propyl-, (8β)-
- (8β)-8-[(Methylsulfinyl)methyl]-6-propylergoline
- Indolo[4,3-fg]quinoline, ergoline deriv.
- Pergolide sulfoxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
Pergolide Sulfoxide ((8β)-8-[(Methylsulfinyl)methyl]-6-propyl-D-ergoline)
CAS:Alkaloids of rye ergot and their derivatives; salts thereof, nesoiFormula:C19H26N2OSColor and Shape:PowderMolecular weight:330.17658




