CAS 72822-03-8
:(8beta,10xi)-8-[(methylsulfonyl)methyl]-6-propylergoline
Description:
The chemical substance known as (8beta,10xi)-8-[(methylsulfonyl)methyl]-6-propylergoline, with the CAS number 72822-03-8, is a member of the ergoline family, which is characterized by a tetracyclic structure derived from the ergot alkaloids. This compound features a methylsulfonyl group, which enhances its solubility and may influence its biological activity. Ergoline derivatives are often studied for their potential pharmacological effects, including interactions with serotonin and dopamine receptors, making them of interest in neuropharmacology. The presence of the propylergoline moiety suggests potential applications in modulating neurotransmitter systems. Additionally, the specific stereochemistry indicated by the nomenclature suggests that the compound may exhibit unique biological properties compared to other ergoline derivatives. Overall, the characteristics of this compound, including its structural features and potential biological activities, make it a subject of interest for further research in medicinal chemistry and pharmacology.
Formula:C19H26N2O2S
InChI:InChI=1/C19H26N2O2S/c1-3-7-21-11-13(12-24(2,22)23)8-16-15-5-4-6-17-19(15)14(10-20-17)9-18(16)21/h4-6,10,13,16,18,20H,3,7-9,11-12H2,1-2H3/t13-,16?,18-/m1/s1
SMILES:CCCN1C[C@@H](CC2c3cccc4c3c(C[C@@H]12)c[nH]4)CS(=O)(=O)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Pergolide Sulfone
CAS:Controlled ProductFormula:C19H26N2O2SColor and Shape:NeatMolecular weight:346.49


