CAS 72824-04-5
:Allylboronic acid pinacol cyclic ester
Description:
Allylboronic acid pinacol cyclic ester, with the CAS number 72824-04-5, is a boron-containing organic compound characterized by its unique structure that includes a boronic acid moiety and a cyclic ester derived from pinacol. This compound typically exhibits properties associated with both boron and ester functionalities, making it useful in various chemical reactions, particularly in organic synthesis and medicinal chemistry. It is known for its ability to participate in cross-coupling reactions, which are essential in the formation of carbon-carbon bonds. The presence of the allyl group enhances its reactivity, allowing it to engage in nucleophilic attacks and other transformations. Additionally, the cyclic ester structure contributes to its stability and solubility in organic solvents. Allylboronic acid pinacol cyclic ester is often utilized as a reagent in the synthesis of complex organic molecules, including pharmaceuticals and agrochemicals, due to its versatility and functional group compatibility. Safety precautions should be observed when handling this compound, as with many boron-containing reagents, to mitigate any potential hazards.
Formula:C8H15BO2
InChI:InChI=1/C8H15BO2/c1-6-9-10-7(2,3)8(4,5)11-9/h6H,1H2,2-5H3
SMILES:C=CB1OC(C)(C)C(C)(C)O1
Synonyms:- 2-Allyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
- 4,4,5,5-Tetramethyl-2-Prop-2-En-1-Yl-1,3,2-Dioxaborolane
- Allylboronic acid pinacol ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-Allyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (stabilized with Phenothiazine)
CAS:Formula:C9H17BO2Purity:>96.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:168.04Allylboronic acid pinacol ester, 98+%
CAS:<p>Allylboronic acid pinacol ester reacts with carboxylic acids, in the presence of tri-n-butyltin hydride, to give homoallylic alcohols in good yield. Homoallylic alcohols can also be formed by allylboration of aldehydes. It is a reagent used for palladium-catalyzed Suzuki-Miyaura cross-coupling react</p>Formula:C9H17BO2Purity:98+%Color and Shape:Clear colorless, LiquidMolecular weight:168.042-Allyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
CAS:Formula:C9H17BO2Purity:98%Color and Shape:LiquidMolecular weight:168.0411Allylboronic acid, pinacol ester
CAS:Allylboronic acid, pinacol esterFormula:C9H17BO2Purity:97%Color and Shape: clear. colourless liquidMolecular weight:168.04g/molAllylboronic acid, pinacol cyclic ester
CAS:Formula:C9H17BO2Purity:98%(stabilized with Phenothiazine)Color and Shape:Liquid, Clear LiquidMolecular weight:168.04Allylboronic acid pinacol ester
CAS:Controlled Product<p>Applications Allylboronic acid pinacol ester<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br></p>Formula:C9H17BO2Color and Shape:NeatMolecular weight:168.04






