CAS 7283-49-0
:1,1'-hexa-1,5-diene-2,5-diyldibenzene
Description:
1,1'-Hexa-1,5-diene-2,5-diyldibenzene, with the CAS number 7283-49-0, is an organic compound characterized by its structure, which includes a central hexadiene chain flanked by two benzene rings. This compound features multiple double bonds, specifically at the 1 and 5 positions of the hexadiene chain, contributing to its reactivity and potential for polymerization. The presence of the benzene rings provides stability and aromatic characteristics, influencing its physical properties such as solubility and melting point. Typically, compounds like this may exhibit properties such as being colorless to pale yellow liquids or solids, depending on their purity and specific structural isomerism. Additionally, due to the presence of multiple unsaturated bonds, it may participate in various chemical reactions, including addition reactions, making it useful in synthetic organic chemistry. Its applications could extend to materials science, particularly in the development of polymers or as intermediates in organic synthesis. However, handling precautions should be observed due to potential reactivity and toxicity associated with unsaturated hydrocarbons.
Formula:C18H18
InChI:InChI=1/C18H18/c1-15(17-9-5-3-6-10-17)13-14-16(2)18-11-7-4-8-12-18/h3-12H,1-2,13-14H2
SMILES:C=C(CCC(=C)c1ccccc1)c1ccccc1
Synonyms:- (1-Methylene-4-phenyl-4-pentenyl)benzene
- 2,5-Diphenyl-1,5-hexadiene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2,5-Diphenyl-1,5-hexadiene
CAS:2,5-Diphenyl-1,5-hexadiene is a molecule with a phenyl group on each end and two unsaturated bonds. The two phenyl groups are substituted with hydrogen atoms. The molecule has an absorption maximum at 340 nm and transitions to the radical cation form when irradiated with UV light. The molecule's transition energies are sensitive to temperature changes and the theory behind it is based on functional theory. This compound's wavelength is in the visible spectrum, so it can be seen by humans.Formula:C18H18Purity:Min. 95%Color and Shape:PowderMolecular weight:234.34 g/mol
