CAS 72830-07-0
:3,4-Dimethoxy-2-Methyl Pyridine N-Oxide
Description:
3,4-Dimethoxy-2-Methyl Pyridine N-Oxide is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of two methoxy groups (-OCH3) at the 3 and 4 positions, along with a methyl group (-CH3) at the 2 position, contributes to its unique properties and reactivity. The N-oxide functional group indicates that the nitrogen atom in the pyridine ring is oxidized, which can influence the compound's electronic properties and reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents due to the presence of the methoxy groups. It is often used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H11NO3
InChI:InChI=1/C8H11NO3/c1-6-8(12-3)7(11-2)4-5-9(6)10/h4-5H,1-3H3
SMILES:Cc1c(c(ccn1=O)OC)OC
Synonyms:- 3,4-Dimethoxy-2-Methylpyridine 1-Oxide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
3,4-Dimethoxy-2-methylpyridine N-oxide
CAS:Formula:C8H11NO3Purity:98%Color and Shape:SolidMolecular weight:169.17783,4-Dimethoxy-2-Methylpyridine 1-Oxide
CAS:3,4-Dimethoxy-2-Methylpyridine 1-OxidePurity:98%Molecular weight:169.18g/mol3,4-Dimethoxy-2-methylpyridine N-Oxide
CAS:Formula:C8H11NO3Color and Shape:NeatMolecular weight:169.183,4-Dimethoxy-2-methylpyridine-N-oxide
CAS:Controlled ProductFormula:C8H11NO3Color and Shape:NeatMolecular weight:169.183,4-Dimethoxy-2-methylpyridine-N-oxide
CAS:3,4-Dimethoxy-2-methylpyridine-N-oxide is a potent inhibitor of somatostatin, which is known to play a role in the regulation of cancer cell growth and apoptosis. This compound has been shown to inhibit the activity of human kinases, including those involved in tumor cell proliferation. 3,4-Dimethoxy-2-methylpyridine-N-oxide is an anticancer agent that can be used to treat various types of cancer. It has also been found to have inhibitory effects on urine quetiapine and Chinese hamster ovary cells. The compound is a potent analog of kinase inhibitors and can be used as a lead compound for developing new drugs with anticancer properties.Formula:C8H11NO3Purity:Min. 95%Molecular weight:169.18 g/mol







