CAS 72830-08-1
:3,4-Dimethoxy-2-pyridinemethanol
Description:
3,4-Dimethoxy-2-pyridinemethanol is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features two methoxy groups (-OCH3) attached to the 3 and 4 positions of the pyridine ring, enhancing its solubility and reactivity. The presence of a hydroxymethyl group (-CH2OH) at the 2-position contributes to its potential as a versatile building block in organic synthesis. The molecular structure suggests that it may exhibit polar characteristics due to the hydroxyl group, which can participate in hydrogen bonding. This compound may be of interest in medicinal chemistry and material science due to its potential biological activity and ability to form various derivatives. Additionally, its unique functional groups may allow for interactions with biological targets, making it a candidate for further research in pharmacology. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of 3,4-Dimethoxy-2-pyridinemethanol should be evaluated in practical applications.
Formula:C8H11NO3
InChI:InChI=1S/C8H11NO3/c1-11-7-3-4-9-6(5-10)8(7)12-2/h3-4,10H,5H2,1-2H3
InChI key:InChIKey=BKTHTLOKUUJKDF-UHFFFAOYSA-N
SMILES:O(C)C=1C(OC)=CC=NC1CO
Synonyms:- (3,4-Dimethoxypyridin-2-Yl)Methanol
- 2-Hydroxy Methyl-3,4-Dimethoxy Pyridine
- 2-Pyridinemethanol, 3,4-dimethoxy-
- 3,4-Dimethoxy-2-(hydroxymethyl)pyridine
- 3,4-Dimethoxy-2-pyridinemethanol
- 2-Hydroxymethyl-3,4-dimethoxypyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
(3,4-Dimethoxypyridin-2-yl)methanol
CAS:Formula:C8H11NO3Purity:98%Color and Shape:SolidMolecular weight:169.1778Pantoprazole Impurity 29
CAS:Formula:C8H11NO3Color and Shape:Pale Yellow SolidMolecular weight:169.183,4-Dimethoxy-2-(hydroxymethyl)pyridine
CAS:Controlled ProductFormula:C8H11NO3Color and Shape:NeatMolecular weight:169.183,4-Dimethoxy-2-hydroxymethylpyridine
CAS:3,4-Dimethoxy-2-hydroxymethylpyridineFormula:C8H11NO3Purity:≥95%Color and Shape:SolidMolecular weight:169.18g/mol3,4-Dimethoxy-2-hydroxymethylpyridine
CAS:<p>Pantoprazole is a proton pump inhibitor (PPI) that blocks the production of stomach acid by inhibiting the H+/K+-ATPase enzyme in gastric parietal cells. The chemical compound 3,4-Dimethoxy-2-hydroxymethylpyridine is a sodium salt of pantoprazole. It is commercially available as the anhydrous form, which is a white crystalline powder. This chemical has been used to regulate the amount of water in industrial processes and to salify materials such as lead oxide. Pantoprazole sodium chloride can be prepared by evaporating and drying with anhydrous sodium chloride or by heating an aqueous solution of pantoprazole sulfate.</p>Formula:C8H11NO3Purity:Min. 95%Color and Shape:PowderMolecular weight:169.18 g/mol(3,4-Dimethoxypyridin-2-yl)methanol
CAS:Formula:C8H11NO3Purity:97%Color and Shape:SolidMolecular weight:169.183,4-Dimethoxy-2-pyridinemethanol
CAS:<p>Applications A novel dimethoxypyridyl-substituted derivative as gastric secretion inhibitors.<br>References Kohl, B., et al.: J. Med. Chem., 35, 1049 (1992),<br></p>Formula:C8H11NO3Color and Shape:NeatMolecular weight:169.18







