CymitQuimica logo

CAS 72832-27-0

:

3-bromothieno[2,3-b]pyridine-2-carbonitrile

Description:
3-Bromothieno[2,3-b]pyridine-2-carbonitrile is a heterocyclic organic compound characterized by its unique structure, which includes a thieno-pyridine framework. This compound features a bromine atom at the 3-position of the thieno ring and a cyano group (-C≡N) at the 2-position of the pyridine ring, contributing to its reactivity and potential applications in medicinal chemistry and material science. The presence of the bromine atom enhances its electrophilic properties, making it a useful intermediate in various chemical reactions, including nucleophilic substitutions. The cyano group adds to the compound's polarity and can participate in further chemical transformations. Typically, compounds of this nature exhibit moderate to high solubility in polar organic solvents, and their physical properties, such as melting point and boiling point, can vary based on the specific substituents and their interactions. Overall, 3-bromothieno[2,3-b]pyridine-2-carbonitrile is of interest for its potential applications in drug development and as a building block in organic synthesis.
Formula:C8H3BrN2S
InChI:InChI=1/C8H3BrN2S/c9-7-5-2-1-3-11-8(5)12-6(7)4-10/h1-3H
Synonyms:
  • 3-Bromothieno[2,3-b]pyridine-2-carbonitrile
  • thieno[2,3-b]pyridine-2-carbonitrile, 3-bromo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.