CymitQuimica logo

CAS 72835-87-1

:

Ethyl 2,6-dichloro-β-oxobenzenepropanoate

Description:
Ethyl 2,6-dichloro-β-oxobenzenepropanoate, with the CAS number 72835-87-1, is an organic compound characterized by its ester functional group and the presence of dichloro substituents on the aromatic ring. This compound typically exhibits a moderate to high level of lipophilicity due to its ethyl ester and aromatic structure, which can influence its solubility in organic solvents. The dichloro groups contribute to its reactivity and potential biological activity, making it of interest in various chemical applications, including synthesis and possibly in agrochemical formulations. The β-oxobenzenepropanoate structure suggests that it may participate in various chemical reactions, such as nucleophilic substitutions or condensation reactions. Additionally, the presence of chlorine atoms can enhance its stability and alter its electronic properties, affecting its interaction with biological systems. Safety data should be consulted for handling and exposure risks, as halogenated compounds can exhibit toxicity or environmental persistence. Overall, this compound's unique structure and properties make it a subject of interest in both synthetic and applied chemistry.
Formula:C11H10Cl2O3
InChI:InChI=1S/C11H10Cl2O3/c1-2-16-10(15)6-9(14)11-7(12)4-3-5-8(11)13/h3-5H,2,6H2,1H3
InChI key:InChIKey=GJUHMKHPXHMWQI-UHFFFAOYSA-N
SMILES:C(CC(OCC)=O)(=O)C1=C(Cl)C=CC=C1Cl
Synonyms:
  • Ethyl 2,6-dichlorobenzoylacetate
  • Ethyl 2,6-dichloro-β-oxobenzenepropanoate
  • Benzenepropanoic acid, 2,6-dichloro-β-oxo-, ethyl ester
Found 4 products.