CAS 72836-32-9
:5-(1-methylbutyl)-1,3,4-thiadiazol-2-amine
Description:
5-(1-Methylbutyl)-1,3,4-thiadiazol-2-amine is an organic compound characterized by its thiadiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features a 1-methylbutyl group, which contributes to its hydrophobic characteristics and influences its solubility and reactivity. The presence of an amine functional group indicates that it can participate in hydrogen bonding, making it potentially useful in various chemical reactions and applications. Thiadiazoles are known for their biological activity, and compounds like this one may exhibit antimicrobial, antifungal, or herbicidal properties. The molecular structure suggests that it could be of interest in agricultural chemistry or pharmaceuticals. Its CAS number, 72836-32-9, allows for easy identification in chemical databases. Overall, the unique combination of functional groups and the thiadiazole framework makes this compound a subject of interest for further research and application in various fields of chemistry.
Formula:C7H13N3S
InChI:InChI=1/C7H13N3S/c1-3-4-5(2)6-9-10-7(8)11-6/h5H,3-4H2,1-2H3,(H2,8,10)
SMILES:CCCC(C)c1n[nH]c(=N)s1
Synonyms:- 1,3,4-Thiadiazol-2-Amine, 5-(1-Methylbutyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
