CAS 72848-57-8
:Tetrafluoro-2-(heptafluoro-1-propoxy)propanoyl chloride
Description:
Tetrafluoro-2-(heptafluoro-1-propoxy)propanoyl chloride is a fluorinated organic compound characterized by its unique structure, which includes a propanoyl chloride moiety and a heptafluoroalkoxy group. This compound is notable for its high fluorine content, which imparts distinct chemical properties such as increased thermal stability, low surface tension, and resistance to chemical degradation. The presence of the propanoyl chloride functional group suggests reactivity typical of acyl chlorides, allowing for potential applications in organic synthesis and as an acylating agent. Additionally, the fluorinated segments contribute to its hydrophobic nature, making it useful in specialized applications such as surfactants, coatings, and materials that require low friction or enhanced chemical resistance. However, due to its fluorinated nature, it may also raise environmental and health concerns, necessitating careful handling and consideration of its lifecycle. Overall, Tetrafluoro-2-(heptafluoro-1-propoxy)propanoyl chloride exemplifies the unique properties of fluorinated compounds in modern chemistry.
Formula:C6ClF11O2
InChI:InChI=1/C6ClF11O2/c7-1(19)2(8,4(11,12)13)20-6(17,18)3(9,10)5(14,15)16
SMILES:C(=O)(C(C(F)(F)F)(F)OC(C(C(F)(F)F)(F)F)(F)F)Cl
Synonyms:- 2,3,3,3-Tetrafluoro-2-(Heptafluoropropoxy)Propanoyl Chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Perfluoro(2-methyl-3-oxahexanoyl) Chloride
CAS:Controlled ProductFormula:C6ClF11O2Color and Shape:NeatMolecular weight:348.5
