CAS 72849-35-5

18-methoxy-18-oxooctadecanoic acid

Description:

18-Methoxy-18-oxooctadecanoic acid, with the CAS number 72849-35-5, is a fatty acid derivative characterized by the presence of a methoxy group and a keto functional group at the terminal carbon of an 18-carbon chain. This compound typically exhibits properties associated with fatty acids, such as being hydrophobic and having a relatively high melting point due to its long carbon chain. The methoxy group introduces polar characteristics, which can enhance its solubility in organic solvents. The keto group can participate in various chemical reactions, including condensation and reduction, making it a versatile intermediate in organic synthesis. This compound may also exhibit biological activity, potentially influencing lipid metabolism or serving as a precursor in the synthesis of bioactive molecules. Its structural features suggest potential applications in pharmaceuticals, agrochemicals, or as a surfactant, although specific applications would depend on further research into its reactivity and biological interactions. Overall, 18-methoxy-18-oxooctadecanoic acid represents a unique compound within the realm of fatty acid derivatives.

Formula: C₁₉H₃₆O₄

InChI: InChI=1/C19H36O4/c1-23-19(22)17-15-13-11-9-7-5-3-2-4-6-8-10-12-14-16-18(20)21/h2-17H2,1H3,(H,20,21)

SMILES: COC(=O)CCCCCCCCCCCCCCCCC(=O)O

Octadecanedioic acid, monomethyl ester

CAS: 72849-35-5

Formula: C₁₉H₃₆O₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 328.4867

Ref: IN-DA00ICBR

18-Methoxy-18-oxooctadecanoic acid

CAS: 72849-35-5

18-Methoxy-18-oxooctadecanoic acid

Purity: 97%

Molecular weight: 328.49g/mol

Ref: 54-OR92384

18-Methoxy-18-oxooctadecanoic acid

CAS: 72849-35-5

Formula: C₁₉H₃₆O₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 328.493

Ref: 10-F540388

18-methoxy-18-oxooctadecanoic acid

CAS: 72849-35-5

Please enquire for more information about 18-methoxy-18-oxooctadecanoic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₉H₃₆O₄

Purity: Min. 95%

Molecular weight: 328.49 g/mol

Ref: 3D-XCA84935