CymitQuimica logo

CAS 72850-79-4

:

ethyl 2-bromo-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate

Description:
Ethyl 2-bromo-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a bromine atom and a trifluoromethyl group, which significantly influence its reactivity and physical properties. The presence of the ethyl ester group contributes to its solubility in organic solvents and may enhance its biological activity. Typically, compounds like this exhibit moderate to high stability under standard conditions, but they can be sensitive to nucleophilic attack due to the electrophilic nature of the bromine and the carbonyl carbon in the carboxylate group. The trifluoromethyl group often imparts unique electronic properties, making the compound of interest in various fields, including medicinal chemistry and agrochemicals. Its specific applications may vary, but it is often explored for its potential biological activities, including antimicrobial or herbicidal properties. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks.
Formula:C7H5BrF3NO2S
InChI:InChI=1/C7H5BrF3NO2S/c1-2-14-5(13)3-4(7(9,10)11)12-6(8)15-3/h2H2,1H3
InChI key:XPAISTXWPBHIMZ-UHFFFAOYSA-N
SMILES:CCOC(=O)c1c(C(F)(F)F)nc(Br)s1
Synonyms:
  • 5-Thiazolecarboxylic acid, 2-bromo-4-(trifluoromethyl)-, ethyl ester
Found 4 products.