CAS 72851-41-3
:benzo[k]fluoranthene-7,12-dicarbonitrile
Description:
Benzo[k]fluoranthene-7,12-dicarbonitrile is a polycyclic aromatic hydrocarbon (PAH) derivative characterized by its complex structure, which includes multiple fused aromatic rings and two cyano groups (-C≡N) attached at the 7 and 12 positions. This compound is known for its potential applications in organic electronics, particularly in organic semiconductors and photovoltaic devices, due to its electronic properties. The presence of cyano groups enhances its electron-accepting capabilities, making it suitable for various chemical reactions and applications in materials science. Additionally, like many PAHs, benzo[k]fluoranthene-7,12-dicarbonitrile may exhibit environmental persistence and potential toxicity, necessitating careful handling and assessment of its ecological impact. Its synthesis typically involves multi-step organic reactions, and it can be analyzed using techniques such as chromatography and spectroscopy to determine its purity and structural integrity. Overall, this compound represents a significant interest in both research and industrial applications, particularly in the fields of organic chemistry and materials science.
Formula:C22H10N2
InChI:InChI=1/C22H10N2/c23-11-18-14-7-1-2-8-15(14)19(12-24)22-17-10-4-6-13-5-3-9-16(20(13)17)21(18)22/h1-10H
SMILES:c1ccc2c(c1)c(C#N)c1c3cccc4cccc(c34)c1c2C#N
Synonyms:- 7,12-DICYANOBENZO[K]FLUORANTHENE
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Benzo[k]fluoranthene-7,12-dicarbonitrile
CAS:Controlled ProductApplications Benzo[k]fluoranthene-7,12-dicarbonitrile is an intermediate in synthesizing Benzo[k]fluoranthene (B203560), which is used as an optical sensor for nitro-aromatic compounds due to fluorescence quenching of the molecule. It is also a carcinogen and mutagen.
References Patra, D. et al.: Sens. Actua. B. Chem., 80, 278 (2001); Wei-Dong, W. et al.: J. Chrom. A., 1173, 27 (2007);Formula:C22H10N2Color and Shape:NeatMolecular weight:302.337,12-Dicyanobenzo[k]fluoranthene
CAS:Controlled ProductFormula:C22H10N2Color and Shape:NeatMolecular weight:302.33

