CAS 7286-46-6
:4-deoxy-D-xylo-hexose
Description:
4-Deoxy-D-xylo-hexose, also known as 4-deoxy-D-xylose, is a monosaccharide that is a derivative of xylose, characterized by the absence of a hydroxyl group at the fourth carbon position. This modification alters its chemical properties and biological functions compared to its parent compound. The molecular formula of 4-deoxy-D-xylo-hexose typically reflects its hexose structure, containing six carbon atoms, while its specific stereochemistry contributes to its classification as a D-isomer. This sugar is often involved in various biochemical pathways and can serve as a building block for more complex carbohydrates. Its CAS number, 7286-46-6, is a unique identifier that facilitates the search for information regarding its properties, synthesis, and applications in scientific literature. In terms of solubility, like many sugars, it is generally soluble in water, and its reactivity can be influenced by the presence of functional groups. Overall, 4-deoxy-D-xylo-hexose plays a role in carbohydrate chemistry and may have implications in biological systems and research.
Formula:C6H12O5
InChI:InChI=1/C6H12O5/c7-2-4(9)1-5(10)6(11)3-8/h3-7,9-11H,1-2H2/t4-,5-,6-/m0/s1
SMILES:C([C@@H](CO)O)[C@@H]([C@H](C=O)O)O
Synonyms:- 4-Deoxy-Alpha-D-Glucose
- D-xylo-hexose, 4-deoxy-
- 4-Deoxy-D-xylo-hexose
- 4-Deoxy-D-xylo-hexos
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-Deoxy-D-glucose
CAS:4-Deoxy-D-glucose is a sugar that is synthesized by the condensation of two molecules of erythrose. It has been shown to be an efficient donor substrate for nucleophilic attack, which can lead to the synthesis of glycosides and other natural products. 4-Deoxy-D-glucose is also a competitive inhibitor of uridine diphosphate (UDP) glucose, which is an enzyme involved in the biosynthesis of UDP sugars and glycoproteins. The concentration of 4-deoxy-D-glucose affects its catalytic mechanism, as it acts as a competitive inhibitor at high concentrations. Molecular modeling has revealed that this molecule adopts a chair conformation with significant solvent exposure.
Formula:C6H12O5Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:164.16 g/molRef: 3D-MD180432
Discontinued product

