
CAS 72876-12-1
:3,6-Dichloro-5-methyl-2-pyrazinecarboxylic acid
Description:
3,6-Dichloro-5-methyl-2-pyrazinecarboxylic acid is a heterocyclic organic compound characterized by its pyrazine ring structure, which contains two chlorine substituents at the 3 and 6 positions and a methyl group at the 5 position, along with a carboxylic acid functional group at the 2 position. This compound is typically a solid at room temperature and is soluble in polar solvents due to the presence of the carboxylic acid group. Its molecular structure contributes to its potential applications in pharmaceuticals, agrochemicals, and as a building block in organic synthesis. The presence of chlorine atoms enhances its reactivity and may influence its biological activity. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, can be determined through various analytical techniques, including NMR and mass spectrometry. Safety data should be consulted to understand its handling and toxicity, as halogenated compounds can exhibit varying degrees of environmental and health impacts.
Formula:C6H4Cl2N2O2
InChI:InChI=1S/C6H4Cl2N2O2/c1-2-4(7)10-3(6(11)12)5(8)9-2/h1H3,(H,11,12)
InChI key:InChIKey=MZXNLFHYDMBZKT-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(Cl)=NC(C)=C(Cl)N1
Synonyms:- Pyrazinecarboxylic acid, 3,6-dichloro-5-methyl-
- 2-Pyrazinecarboxylic acid, 3,6-dichloro-5-methyl-
- 3,6-Dichloro-5-methyl-2-pyrazinecarboxylic acid
- 3,6-Dichloro-5-methylpyrazinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3,6-Dichloro-5-methylpyrazine-2-carboxylic acid
CAS:Formula:C6H4Cl2N2O2Color and Shape:SolidMolecular weight:207.0142
