CAS 72877-97-5
:Bismuth 2-ethylhexanoate
Description:
Bismuth 2-ethylhexanoate, with the CAS number 72877-97-5, is an organometallic compound that serves primarily as a catalyst in various chemical reactions, particularly in the field of polymerization and coatings. It is characterized by its bismuth center, which is coordinated to 2-ethylhexanoate ligands, providing it with unique properties. This compound is typically a white to pale yellow solid and is soluble in organic solvents, making it suitable for applications in organic synthesis. Bismuth 2-ethylhexanoate is notable for being a non-toxic alternative to traditional heavy metal catalysts, aligning with the growing emphasis on environmentally friendly chemistry. Its catalytic activity is often utilized in the production of polyurethanes and other polymers, where it facilitates reactions without the harmful effects associated with lead or tin-based catalysts. Additionally, it exhibits thermal stability, which is advantageous in high-temperature processes. Overall, bismuth 2-ethylhexanoate represents a valuable compound in modern chemical applications, combining efficacy with reduced environmental impact.
Formula:C8H16O2·xBi
InChI:InChI=1S/C8H16O2.Bi/c1-3-5-6-7(4-2)8(9)10;/h7H,3-6H2,1-2H3,(H,9,10);
InChI key:InChIKey=NNFNMTHLSPQNHF-UHFFFAOYSA-N
SMILES:C(CCCC)(C(O)=O)CC.[Bi]
Synonyms:- Hexanoic acid, 2-ethyl-, bismuth salt
- Bismuth 2-ethylhexanoate
- Catalyst 320
- Hexanoic acid, 2-ethyl-, bismuth salt (1:?)
- Octope Bi
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
