CAS 72878-29-6
:2-(trimethoxysilyl)ethyl acetate
Description:
2-(Trimethoxysilyl)ethyl acetate, with the CAS number 72878-29-6, is an organosilicon compound characterized by the presence of both silane and acetate functional groups. This compound typically appears as a colorless to pale yellow liquid and is soluble in organic solvents while exhibiting limited solubility in water. Its structure features a trimethoxysilyl group, which enhances its reactivity and ability to bond with various substrates, making it useful as a coupling agent or surface modifier in materials science and coatings. The acetate group contributes to its reactivity, allowing for potential applications in adhesives, sealants, and as a precursor in the synthesis of silicate materials. Additionally, 2-(trimethoxysilyl)ethyl acetate can improve the adhesion properties of polymers and enhance the durability of composite materials. Safety considerations include handling it in well-ventilated areas and using appropriate personal protective equipment, as it may cause irritation upon contact with skin or eyes. Overall, its unique chemical properties make it valuable in various industrial applications.
Formula:C7H16O5Si
InChI:InChI=1/C7H16O5Si/c1-7(8)12-5-6-13(9-2,10-3)11-4/h5-6H2,1-4H3
SMILES:CC(=O)OCC[Si](OC)(OC)OC
Synonyms:- Ethanol, 2-(trimethoxysilyl)-, acetate
- 2-(Trimethoxysilyl)ethyl acetate
- ACETOXYETHYL TRIMETHOXYSILANE
- Ethanol, 2-(trimethoxysilyl)-, 1-acetate
- 2-Acetoxyethyl Trimethoxysilane
- 2-trimethoxysilylethyl acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Acetoxyethyl trimethoxysilane
CAS:<p>S00019 - Acetoxyethyl trimethoxysilane</p>Formula:C7H16O5SiColor and Shape:ClearMolecular weight:208.285
