CAS 72886-42-1
:methyl 3-sulfanylbenzoate
Description:
Methyl 3-sulfanylbenzoate, with the CAS number 72886-42-1, is an organic compound characterized by the presence of a benzoate moiety substituted with a methyl group and a sulfanyl (thiol) functional group. This compound typically exhibits a molecular structure that includes a benzene ring, which contributes to its aromatic properties, and a methyl ester group that enhances its solubility in organic solvents. The sulfanyl group introduces a thiol functionality, which can impart distinct reactivity and potential for forming disulfide bonds or participating in nucleophilic reactions. Methyl 3-sulfanylbenzoate may possess a characteristic odor, often associated with thiols, and can be used in various applications, including as a flavoring agent or in synthetic organic chemistry. Its physical properties, such as boiling point and solubility, are influenced by the presence of both the aromatic and functional groups. Safety data should be consulted for handling and usage, as thiol compounds can be sensitive to oxidation and may have specific health implications.
Formula:C8H8O2S
InChI:InChI=1/C8H8O2S/c1-10-8(9)6-3-2-4-7(11)5-6/h2-5,11H,1H3
SMILES:COC(=O)c1cccc(c1)S
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Methyl-3-mercaptobenzoate
CAS:Formula:C8H8O2SPurity:95%Color and Shape:LiquidMolecular weight:168.2129Methyl 3-mercaptobenzoate
CAS:Methyl 3-mercaptobenzoate is a specific transport agent that is used to transport salicylaldehyde from the leaves of plants to the coleoptera. The mechanism of this transport process has not been fully elucidated, but it is thought that the 3-mercapto group may form a covalent bond with the chrysomelidae which then allows for transport. This mechanism has not been confirmed, but it is thought that in some cases, methyl 3-mercaptobenzoate may also be able to transport iridoid glucosides. Methyl 3-mercaptobenzoate is most effective when used in conjunction with other agents like chrysomelidae and salicylaldehyde.Formula:C8H8O2SPurity:Min. 95%Color and Shape:Colorless PowderMolecular weight:168.21 g/molMethyl 3-Mercaptobenzoate, ~85%
CAS:Controlled ProductFormula:C8H8O2SPurity:~85%Color and Shape:NeatMolecular weight:168.21





