CAS 728864-60-6

2,6-Dimethylimidazo[1,2-a]pyridine-3-carboxaldehyde

Description:

2,6-Dimethylimidazo[1,2-a]pyridine-3-carboxaldehyde is an organic compound characterized by its imidazo-pyridine structure, which includes a fused ring system containing nitrogen atoms. This compound features a carboxaldehyde functional group, contributing to its reactivity and potential applications in organic synthesis. It is typically a yellow to brown solid at room temperature and is soluble in organic solvents. The presence of methyl groups at the 2 and 6 positions of the imidazo ring influences its chemical properties, including its stability and reactivity. This compound is of interest in various fields, including medicinal chemistry and material science, due to its potential biological activity and utility in synthesizing other complex molecules. Additionally, it may be studied for its role in the formation of heterocyclic compounds and its implications in food chemistry, particularly concerning the formation of mutagenic substances during cooking processes. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₀H₁₀N₂O

InChI: InChI=1S/C10H10N2O/c1-7-3-4-10-11-8(2)9(6-13)12(10)5-7/h3-6H,1-2H3

InChI key: InChIKey=LXBYSLXINCYUQH-UHFFFAOYSA-N

SMILES: C(=O)C=1N2C(=NC1C)C=CC(C)=C2

Synonyms:

• 2,6-Dimethylimidazo[1,2-a]pyridine-3-carboxaldehyde
• Imidazo[1,2-a]pyridine-3-carboxaldehyde, 2,6-dimethyl-
• 2,6-Dimethylimidazo[1,2-a]pyridine-3-carbaldehyde

2,6-Dimethyl-imidazo[1,2-a]pyridine-3-carbaldehyde

CAS: 728864-60-6

Formula: C₁₀H₁₀N₂O

Color and Shape: Solid

Molecular weight: 174.203

Ref: 10-F020624