CAS 728864-66-2

4-[[(Dibutylamino)carbonyl]amino]benzenesulfonyl chloride

Description:

4-[[(Dibutylamino)carbonyl]amino]benzenesulfonyl chloride, with the CAS number 728864-66-2, is a chemical compound characterized by its sulfonyl chloride functional group, which is known for its reactivity and ability to form sulfonamides. This compound features a benzenesulfonyl moiety attached to an amino group that is further substituted with a dibutylamino carbonyl group. The presence of the dibutylamino group suggests that it may exhibit lipophilic properties, potentially influencing its solubility and biological activity. As a sulfonyl chloride, it is likely to be a reactive intermediate in organic synthesis, particularly in the formation of sulfonamides or other derivatives. The compound may also possess applications in medicinal chemistry, given the presence of the amino and sulfonyl functionalities, which can be pivotal in drug design. However, due to the presence of the sulfonyl chloride group, it may be corrosive and should be handled with appropriate safety precautions.

Formula: C₁₅H₂₃ClN₂O₃S

InChI: InChI=1S/C15H23ClN2O3S/c1-3-5-11-18(12-6-4-2)15(19)17-13-7-9-14(10-8-13)22(16,20)21/h7-10H,3-6,11-12H2,1-2H3,(H,17,19)

InChI key: InChIKey=JCPRHFBMTAGWDR-UHFFFAOYSA-N

SMILES: N(C(N(CCCC)CCCC)=O)C1=CC=C(S(Cl)(=O)=O)C=C1

Synonyms:

• 4-[[(Dibutylamino)carbonyl]amino]benzenesulfonyl chloride
• Benzenesulfonyl chloride, 4-[[(dibutylamino)carbonyl]amino]-

4-(3,3-Dibutyl-ureido)-benzenesulfonyl chloride

CAS: 728864-66-2

Formula: C₁₅H₂₃ClN₂O₃S

Purity: 98%

Color and Shape: Solid

Molecular weight: 346.87

Ref: 10-F020650