CAS 728864-79-7
:5-[(2,2-Dimethyl-1-oxopropyl)ethylamino]-1-naphthalenesulfonyl chloride
Description:
5-[(2,2-Dimethyl-1-oxopropyl)ethylamino]-1-naphthalenesulfonyl chloride, with the CAS number 728864-79-7, is a chemical compound characterized by its sulfonyl chloride functional group, which is known for its reactivity and ability to form sulfonamides. This compound features a naphthalene ring, contributing to its aromatic properties, and an amine group that enhances its potential for various chemical reactions, particularly in the synthesis of more complex molecules. The presence of the dimethyl-1-oxopropyl substituent adds steric bulk, which can influence its reactivity and solubility in different solvents. Typically, sulfonyl chlorides are utilized in organic synthesis as electrophiles, particularly in the formation of sulfonamides and other derivatives. The compound's structure suggests it may exhibit biological activity, making it of interest in pharmaceutical research. However, due to the presence of the sulfonyl chloride group, it is also important to handle this substance with care, as it can be corrosive and reactive with water and other nucleophiles.
Formula:C17H20ClNO3S
InChI:InChI=1S/C17H20ClNO3S/c1-5-19(16(20)17(2,3)4)14-10-6-9-13-12(14)8-7-11-15(13)23(18,21)22/h6-11H,5H2,1-4H3
InChI key:InChIKey=RBFDWDFCPDFAKD-UHFFFAOYSA-N
SMILES:N(C(C(C)(C)C)=O)(CC)C=1C2=C(C(S(Cl)(=O)=O)=CC=C2)C=CC1
Synonyms:- 1-Naphthalenesulfonyl chloride, 5-[(2,2-dimethyl-1-oxopropyl)ethylamino]-
- 5-[(2,2-Dimethyl-1-oxopropyl)ethylamino]-1-naphthalenesulfonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.