CAS 728864-91-3

5-(3-Oxo-3-phenyl-1-propen-1-yl)-2-thiophenesulfonyl chloride

Description:

5-(3-Oxo-3-phenyl-1-propen-1-yl)-2-thiophenesulfonyl chloride is a chemical compound characterized by its unique structure, which includes a thiophene ring and a sulfonyl chloride functional group. This compound typically exhibits properties associated with both electrophilic and nucleophilic reactivity due to the presence of the sulfonyl chloride, making it useful in various synthetic applications, particularly in organic synthesis and medicinal chemistry. The presence of the phenyl group and the keto-enol system contributes to its potential as a reactive intermediate in the formation of more complex molecules. Additionally, the compound may display moderate to high solubility in organic solvents, while its reactivity with water and other nucleophiles can lead to hydrolysis, forming sulfonic acids. Safety precautions are essential when handling this compound, as sulfonyl chlorides can be corrosive and may release toxic gases upon reaction with moisture. Overall, this compound serves as a valuable building block in the development of pharmaceuticals and agrochemicals.

Formula: C₁₃H₉ClO₃S₂

InChI: InChI=1S/C13H9ClO3S2/c14-19(16,17)13-9-7-11(18-13)6-8-12(15)10-4-2-1-3-5-10/h1-9H

InChI key: InChIKey=WMGRSYDWDSOZQG-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C=1SC(C=CC(=O)C2=CC=CC=C2)=CC1

Synonyms:

• 2-Thiophenesulfonyl chloride, 5-(3-oxo-3-phenyl-1-propen-1-yl)-
• 2-Thiophenesulfonyl chloride, 5-(3-oxo-3-phenyl-1-propenyl)-
• 5-(3-Oxo-3-phenyl-1-propen-1-yl)-2-thiophenesulfonyl chloride