CymitQuimica logo

CAS 72888-55-2

:

(5R,6R)-3-[(2-aminoethyl)sulfanyl]-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid

Description:
The chemical substance known as (5R,6R)-3-[(2-aminoethyl)sulfanyl]-6-[(1R)-1-hydroxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid, with the CAS number 72888-55-2, is a bicyclic compound featuring a thiazolidine ring structure. This compound is characterized by the presence of a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The molecule also contains a sulfenyl group, which can participate in various chemical reactions, including nucleophilic substitutions. The stereochemistry indicated by the (5R,6R) and (1R) designations suggests specific spatial arrangements of the substituents, which can influence the compound's biological activity and interactions. This substance is of interest in medicinal chemistry, particularly for its potential applications in antibiotic development, as it may exhibit activity against certain bacterial strains. Its unique structural features, including the bicyclic framework and functional groups, contribute to its chemical properties and potential therapeutic uses.
Formula:C10H14N2O4S2
InChI:InChI=1/C10H14N2O4S2/c1-4(13)5-7(14)12-6(9(15)16)10(17-3-2-11)18-8(5)12/h4-5,8,13H,2-3,11H2,1H3,(H,15,16)/t4-,5-,8-/m1/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • Sch 33755

    CAS:
    Sch 33755 is a bioactive chemical.
    Formula:C10H14N2O4S2
    Color and Shape:Solid
    Molecular weight:290.35

    Ref: TM-T34569

    25mg
    To inquire
    50mg
    To inquire
    100mg
    To inquire