CAS 728898-92-8

Ethyl 2-[(2-chloro-1-oxopropyl)amino]-4-phenyl-3-thiophenecarboxylate

Description:

Ethyl 2-[(2-chloro-1-oxopropyl)amino]-4-phenyl-3-thiophenecarboxylate, with the CAS number 728898-92-8, is a synthetic organic compound characterized by its complex structure, which includes an ethyl ester group, a thiophene ring, and a chloro-substituted propylamine moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the thiophene ring may contribute to its electronic properties, making it of interest in medicinal chemistry and material science. Additionally, the chloro group can enhance reactivity, allowing for further chemical modifications. The compound's unique structure suggests potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. However, specific physical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from chemical databases for precise applications and handling guidelines.

Formula: C₁₆H₁₆ClNO₃S

InChI: InChI=1S/C16H16ClNO3S/c1-3-21-16(20)13-12(11-7-5-4-6-8-11)9-22-15(13)18-14(19)10(2)17/h4-10H,3H2,1-2H3,(H,18,19)

InChI key: InChIKey=WHILVUAIISUSNW-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1C(=CSC1NC(C(C)Cl)=O)C2=CC=CC=C2

Synonyms:

• 3-Thiophenecarboxylic acid, 2-[(2-chloro-1-oxopropyl)amino]-4-phenyl-, ethyl ester
• Ethyl 2-[(2-chloro-1-oxopropyl)amino]-4-phenyl-3-thiophenecarboxylate

Ethyl 2-(2-chloropropanamido)-4-phenylthiophene-3-carboxylate

CAS: 728898-92-8

Versatile small molecule scaffold

Formula: C₁₆H₁₆ClNO₃S

Purity: Min. 95%

Molecular weight: 337.8 g/mol

Ref: 3D-DEB89892