CAS 728918-88-5

1-Methylethyl 3′-amino[1,1′-biphenyl]-3-carboxylate

Description:

1-Methylethyl 3′-amino[1,1′-biphenyl]-3-carboxylate, identified by its CAS number 728918-88-5, is a chemical compound that belongs to the class of carboxylate esters. This substance features a biphenyl structure, which consists of two phenyl rings connected by a single bond, and is substituted with an amino group and a carboxylate moiety. The presence of the methylethyl group indicates that it has branched alkyl characteristics, which can influence its solubility and reactivity. The amino group can participate in hydrogen bonding and may affect the compound's biological activity, making it of interest in pharmaceutical applications. Additionally, the carboxylate group can engage in various chemical reactions, including esterification and amidation. Overall, the compound's unique structure suggests potential utility in organic synthesis and medicinal chemistry, although specific properties such as melting point, boiling point, and solubility would require empirical measurement for precise characterization.

Formula: C₁₆H₁₇NO₂

InChI: InChI=1S/C16H17NO2/c1-11(2)19-16(18)14-7-3-5-12(9-14)13-6-4-8-15(17)10-13/h3-11H,17H2,1-2H3

InChI key: InChIKey=UAYJZJLGTXJRKF-UHFFFAOYSA-N

SMILES: C(OC(C)C)(=O)C=1C=C(C=CC1)C2=CC(N)=CC=C2

Synonyms:

• 1-Methylethyl 3′-amino[1,1′-biphenyl]-3-carboxylate
• [1,1′-Biphenyl]-3-carboxylic acid, 3′-amino-, 1-methylethyl ester