CymitQuimica logo

CAS 728918-92-1

:

4′-(Methylthio)[1,1′-biphenyl]-3-carboxylic acid

Description:
4′-(Methylthio)[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a methylthio group (-S-CH3) at the para position relative to the carboxylic acid (-COOH) functional group significantly influences its chemical properties, including its solubility and reactivity. This compound typically exhibits moderate polarity due to the carboxylic acid group, which can participate in hydrogen bonding, enhancing its solubility in polar solvents. The methylthio group can also affect the compound's electronic properties, potentially influencing its behavior in chemical reactions and interactions with biological systems. Additionally, the compound may exhibit acidic properties due to the carboxylic acid group, allowing it to donate protons in solution. Overall, 4′-(Methylthio)[1,1′-biphenyl]-3-carboxylic acid is of interest in various fields, including medicinal chemistry and materials science, due to its unique structural features and potential applications.
Formula:C14H12O2S
InChI:InChI=1S/C14H12O2S/c1-17-13-7-5-10(6-8-13)11-3-2-4-12(9-11)14(15)16/h2-9H,1H3,(H,15,16)
InChI key:InChIKey=BJBNXCLQJHPZDB-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C=CC1)C2=CC=C(SC)C=C2
Synonyms:
  • [1,1′-Biphenyl]-3-carboxylic acid, 4′-(methylthio)-
  • 4′-(Methylthio)[1,1′-biphenyl]-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.