CAS 728918-93-2

4'-(methylsulfanyl)biphenyl-3-carbaldehyde

Description:

4'-(Methylsulfanyl)biphenyl-3-carbaldehyde, with the CAS number 728918-93-2, is an organic compound characterized by its biphenyl structure substituted with a methylsulfanyl group and an aldehyde functional group. This compound features a biphenyl backbone, which consists of two phenyl rings connected by a single bond, enhancing its stability and potential for various chemical reactions. The methylsulfanyl group (-S-CH3) introduces a sulfur atom into the structure, which can influence the compound's reactivity and solubility properties. The presence of the aldehyde group (-CHO) at the 3-position of the biphenyl ring makes it a reactive site for further chemical transformations, such as condensation reactions or nucleophilic additions. This compound may exhibit interesting properties such as fluorescence or specific interactions with biological targets, making it of interest in fields like organic synthesis, materials science, and medicinal chemistry. Its unique structure allows for potential applications in the development of new materials or pharmaceuticals.

Formula: C₁₄H₁₂OS

InChI: InChI=1/C14H12OS/c1-16-14-7-5-12(6-8-14)13-4-2-3-11(9-13)10-15/h2-10H,1H3

SMILES: CSc1ccc(cc1)c1cccc(c1)C=O

Synonyms:

• [1,1'-Biphenyl]-3-carboxaldehyde, 4'-(methylthio)-
• 4'-(Methylsulfanyl)biphenyl-3-carbaldehyde

4′-Methylsulfanyl-biphenyl-3-carbaldehyde

CAS: 728918-93-2

Formula: C₁₄H₁₂OS

Color and Shape: Solid

Molecular weight: 228.31

Ref: 10-F020814