CAS 728918-96-5
:4′-(Methylthio)[1,1′-biphenyl]-3-amine
Description:
4′-(Methylthio)[1,1′-biphenyl]-3-amine, with the CAS number 728918-96-5, is an organic compound characterized by its biphenyl structure substituted with a methylthio group and an amine functional group. This compound typically exhibits properties associated with aromatic amines, such as potential solubility in organic solvents and moderate stability under standard conditions. The presence of the methylthio group can influence its electronic properties, potentially enhancing its reactivity in nucleophilic substitution reactions. Additionally, the biphenyl framework may contribute to its hydrophobic characteristics, affecting its interactions in biological systems and its potential applications in pharmaceuticals or materials science. As with many organic compounds, safety considerations are important, as amines can be toxic or irritating, and proper handling and disposal protocols should be followed. Overall, this compound's unique structure may offer interesting avenues for research in synthetic chemistry and material applications.
Formula:C13H13NS
InChI:InChI=1S/C13H13NS/c1-15-13-7-5-10(6-8-13)11-3-2-4-12(14)9-11/h2-9H,14H2,1H3
InChI key:InChIKey=CCIYYICNCOTNNV-UHFFFAOYSA-N
SMILES:NC=1C=C(C=CC1)C2=CC=C(SC)C=C2
Synonyms:- 4′-(Methylthio)[1,1′-biphenyl]-3-amine
- [1,1′-Biphenyl]-3-amine, 4′-(methylthio)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4′-(Methylthio)-[1,1′-biphenyl]-3-amine
CAS:Formula:C13H13NSColor and Shape:SolidMolecular weight:215.31
