CAS 728919-23-1
:3′,4′-Dimethyl[1,1′-biphenyl]-2-carboxaldehyde
Description:
3′,4′-Dimethyl[1,1′-biphenyl]-2-carboxaldehyde, with the CAS number 728919-23-1, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two methyl groups at the 3′ and 4′ positions on one of the phenyl rings contributes to its hydrophobic nature and can influence its reactivity and solubility in organic solvents. The aldehyde functional group (-CHO) at the 2-position of the biphenyl framework is significant for its chemical reactivity, allowing it to participate in various reactions such as nucleophilic addition and condensation. This compound may exhibit interesting optical and electronic properties due to its conjugated system, making it potentially useful in materials science and organic synthesis. Additionally, its structural features may allow for specific interactions in biological systems, warranting further investigation into its potential applications in pharmaceuticals or agrochemicals. Overall, 3′,4′-Dimethyl[1,1′-biphenyl]-2-carboxaldehyde is a versatile compound with unique characteristics stemming from its molecular structure.
Formula:C15H14O
InChI:InChI=1S/C15H14O/c1-11-7-8-13(9-12(11)2)15-6-4-3-5-14(15)10-16/h3-10H,1-2H3
InChI key:InChIKey=WXTPNRWHRDSVQH-UHFFFAOYSA-N
SMILES:C(=O)C1=C(C=CC=C1)C2=CC(C)=C(C)C=C2
Synonyms:- 3′,4′-Dimethyl-biphenyl-2-carbaldehyde
- 2-(3,4-Dimethylphenyl)benzaldehyde
- 3′,4′-Dimethyl[1,1′-biphenyl]-2-carboxaldehyde
- [1,1′-Biphenyl]-2-carboxaldehyde, 3′,4′-dimethyl-
- 3',4'-DIMETHYL-BIPHENYL-2-CARBALDEHYDE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.