
CAS 728919-24-2
:3′,4′-Dimethyl[1,1′-biphenyl]-3-amine
Description:
3′,4′-Dimethyl[1,1′-biphenyl]-3-amine, with the CAS number 728919-24-2, is an organic compound characterized by its biphenyl structure substituted with two methyl groups and an amino group. This compound features a biphenyl backbone, which consists of two phenyl rings connected by a single bond, enhancing its stability and potential for various chemical interactions. The presence of the amino group (-NH2) at the 3-position of the biphenyl structure contributes to its reactivity, making it a candidate for further chemical modifications or applications in organic synthesis. The methyl groups at the 3′ and 4′ positions provide steric hindrance, which can influence the compound's physical properties, such as solubility and melting point. Additionally, this compound may exhibit interesting electronic properties due to the conjugation between the amino group and the biphenyl system, potentially making it useful in materials science or as a building block in pharmaceuticals. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C14H15N
InChI:InChI=1S/C14H15N/c1-10-6-7-13(8-11(10)2)12-4-3-5-14(15)9-12/h3-9H,15H2,1-2H3
InChI key:InChIKey=HDZFUSLSIHQFOF-UHFFFAOYSA-N
SMILES:CC=1C=C(C=CC1C)C2=CC(N)=CC=C2
Synonyms:- [1,1′-Biphenyl]-3-amine, 3′,4′-dimethyl-
- 3′,4′-Dimethyl[1,1′-biphenyl]-3-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.