CAS 728920-02-3

(1R)-2,3-Dihydro-1-isocyano-1H-indene

Description:

(1R)-2,3-Dihydro-1-isocyano-1H-indene, with the CAS number 728920-02-3, is a chemical compound characterized by its unique bicyclic structure, which includes an indene framework. This compound features an isocyanide functional group, which is known for its reactivity and ability to participate in various organic reactions, such as the formation of isocyanide-based ligands in coordination chemistry. The presence of the isocyanide group also imparts distinctive properties, including potential applications in medicinal chemistry and material science. The stereochemistry indicated by the (1R) designation suggests a specific spatial arrangement of atoms, which can influence the compound's reactivity and interaction with biological systems. Additionally, the dihydro configuration indicates that the compound has undergone partial hydrogenation, affecting its stability and reactivity. Overall, (1R)-2,3-Dihydro-1-isocyano-1H-indene is a compound of interest in synthetic organic chemistry, particularly for its potential utility in the development of novel chemical entities.

Formula: C₁₀H₉N

InChI: InChI=1S/C10H9N/c1-11-10-7-6-8-4-2-3-5-9(8)10/h2-5,10H,6-7H2/t10-/m1/s1

InChI key: InChIKey=KNXCHLLQHRSRIT-SNVBAGLBSA-N

SMILES: [N+](#[C-])[C@H]1C=2C(CC1)=CC=CC2

Synonyms:

• (1R)-2,3-Dihydro-1-isocyano-1H-indene
• 1H-Indene, 2,3-dihydro-1-isocyano-, (1R)-