CymitQuimica logo

CAS 728920-04-5

:

2-Bromo-1-fluoro-4-(isocyanomethyl)benzene

Description:
2-Bromo-1-fluoro-4-(isocyanomethyl)benzene is an organic compound characterized by the presence of both bromine and fluorine substituents on a benzene ring, along with an isocyanomethyl group. The bromine atom is located at the second position, while the fluorine is at the first position of the aromatic ring, and the isocyanomethyl group is attached at the fourth position. This compound is likely to exhibit significant reactivity due to the presence of the isocyanomethyl group, which can participate in various chemical reactions, including nucleophilic additions and cycloadditions. The halogen substituents (bromine and fluorine) can influence the compound's electronic properties, making it more electrophilic and potentially enhancing its reactivity in substitution reactions. Additionally, the presence of these halogens can affect the compound's solubility and boiling point. Overall, 2-Bromo-1-fluoro-4-(isocyanomethyl)benzene is a versatile compound that may find applications in organic synthesis and materials science.
Formula:C8H5BrFN
InChI:InChI=1S/C8H5BrFN/c1-11-5-6-2-3-8(10)7(9)4-6/h2-4H,5H2
InChI key:InChIKey=UBMUPMXVMRQQLA-UHFFFAOYSA-N
SMILES:C([N+]#[C-])C1=CC(Br)=C(F)C=C1
Synonyms:
  • 2-Bromo-1-fluoro-4-(isocyanomethyl)benzene
  • 3-Bromo-4-fluorobenzylisocyanide
  • Benzene, 2-bromo-1-fluoro-4-(isocyanomethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.