CAS 728930-30-1

(1S)-N-(1H-indol-2-ylmethyl)-1-(1-naphthyl)ethanamine hydrochloride

Description:

(1S)-N-(1H-indol-2-ylmethyl)-1-(1-naphthyl)ethanamine hydrochloride, with the CAS number 728930-30-1, is a chemical compound characterized by its complex structure, which includes an indole moiety and a naphthyl group. This compound is typically classified as a selective serotonin receptor agonist, indicating its potential role in modulating serotonin pathways in biological systems. The presence of the indole structure suggests that it may exhibit properties similar to other indole-based compounds, which are often associated with neuroactive effects. The hydrochloride salt form enhances its solubility in water, making it more suitable for various applications, including pharmacological studies. Its stereochemistry, indicated by the (1S) designation, implies specific spatial arrangements that can influence its biological activity and interaction with receptors. Overall, this compound is of interest in medicinal chemistry and pharmacology, particularly in the context of developing therapeutic agents targeting serotonin-related disorders.

Formula: C₂₁H₂₁ClN₂

InChI: InChI=1/C21H20N2.ClH/c1-15(19-11-6-9-16-7-2-4-10-20(16)19)22-14-18-13-17-8-3-5-12-21(17)23-18;/h2-13,15,22-23H,14H2,1H3;1H/t15-;/m0./s1

SMILES: C[C@@H](c1cccc2ccccc12)NCc1cc2ccccc2[nH]1.Cl

ent-Calindol Hydrochloride

Controlled Product

CAS: 728930-30-1

Formula: C₂₁H₂₀N₂·ClH

Color and Shape: Neat

Molecular weight: 336.86

Ref: TR-C148705