CAS 728948-32-1

4-Bromo-N-(2-methoxyethyl)-N-methylbenzenemethanamine

Description:

4-Bromo-N-(2-methoxyethyl)-N-methylbenzenemethanamine, with the CAS number 728948-32-1, is a chemical compound characterized by its unique structure, which includes a bromine atom, a methoxyethyl group, and a methyl group attached to a benzene ring. This compound is classified as an amine due to the presence of the amine functional group (-NH-). The bromine substituent enhances its reactivity and can influence its biological activity, making it of interest in medicinal chemistry. The methoxyethyl group contributes to its solubility and potential interactions with biological systems. Typically, compounds like this may exhibit properties such as moderate to high polarity, which can affect their distribution and absorption in biological contexts. Additionally, the presence of both bromine and methoxy groups may impart specific pharmacological properties, making it a candidate for further research in drug development. Safety and handling precautions should be observed due to the potential toxicity associated with brominated compounds and amines.

Formula: C₁₁H₁₆BrNO

InChI: InChI=1S/C11H16BrNO/c1-13(7-8-14-2)9-10-3-5-11(12)6-4-10/h3-6H,7-9H2,1-2H3

InChI key: InChIKey=GRZPMTOWGXQEPE-UHFFFAOYSA-N

SMILES: C(N(CCOC)C)C1=CC=C(Br)C=C1

Synonyms:

• Benzenemethanamine, 4-bromo-N-(2-methoxyethyl)-N-methyl-
• 4-Bromo-N-(2-methoxyethyl)-N-methylbenzenemethanamine
• [(4-Bromophenyl)methyl](2-methoxyethyl)methylamine