CAS 729-17-9

Methyl 4'-methoxybiphenyl-4-carboxylate

Description:

Methyl 4'-methoxybiphenyl-4-carboxylate, with the CAS number 729-17-9, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a methoxy group (-OCH3) and a carboxylate group (-COOCH3) attached to the biphenyl framework, contributing to its chemical reactivity and properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. Methyl 4'-methoxybiphenyl-4-carboxylate is known for its applications in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. Its molecular structure allows for various chemical reactions, including esterification and substitution reactions. Additionally, it may exhibit specific physical properties such as solubility in organic solvents and moderate stability under standard conditions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₅H₁₄O₃

InChI: InChI=1/C15H14O3/c1-17-14-9-7-12(8-10-14)11-3-5-13(6-4-11)15(16)18-2/h3-10H,1-2H3

SMILES: COC1=CC=C(C=C1)C1=CC=C(C=C1)C(=O)OC

Synonyms:

• [1,1'-Biphenyl]-4-Carboxylic Acid, 4'-Methoxy-, Methyl Ester
• Methyl 4'-methoxybiphenyl-4-carboxylate

methyl 4-(4-methoxyphenyl)benzoate

CAS: 729-17-9

Formula: C₁₅H₁₄O₃

Purity: 95%

Molecular weight: 242.2699

Ref: IN-DA005DZM

Methyl 4'-methoxy-[1,1'-biphenyl]-4-carboxylate

CAS: 729-17-9

Methyl 4'-methoxy-[1,1'-biphenyl]-4-carboxylate

Purity: ≥95%

Molecular weight: 242.27g/mol

Ref: 54-OR52005

Methyl 4′-methoxybiphenyl-4-carboxylate

CAS: 729-17-9

Formula: C₁₅H₁₄O₃

Purity: 95%

Molecular weight: 242.274

Ref: 10-F200799