CAS 72908-12-4

(2-Chloro-3-pyridinyl)-1-piperazinylmethanone

Description:

(2-Chloro-3-pyridinyl)-1-piperazinylmethanone, identified by its CAS number 72908-12-4, is a chemical compound that features a piperazine moiety linked to a pyridine ring. This compound typically exhibits characteristics common to heterocyclic amines, including potential basicity due to the presence of nitrogen atoms in both the piperazine and pyridine structures. The chloro substituent on the pyridine ring can influence its reactivity and solubility, often enhancing its lipophilicity. This compound may be of interest in medicinal chemistry, particularly for its potential biological activity, as derivatives of piperazine and pyridine are frequently explored for their pharmacological properties. Its molecular structure suggests it could interact with various biological targets, making it a candidate for further research in drug development. Additionally, the presence of functional groups may affect its stability and reactivity under different conditions, which is crucial for applications in synthesis and formulation. Overall, (2-Chloro-3-pyridinyl)-1-piperazinylmethanone represents a versatile scaffold in organic and medicinal chemistry.

Formula: C₁₀H₁₂ClN₃O

InChI: InChI=1S/C10H12ClN3O/c11-9-8(2-1-3-13-9)10(15)14-6-4-12-5-7-14/h1-3,12H,4-7H2

InChI key: InChIKey=GOUVYOXCKSRCHY-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(Cl)N=CC=C1)N2CCNCC2

Synonyms:

• Methanone, (2-chloro-3-pyridinyl)-1-piperazinyl-
• Piperazine, 1-[(2-chloro-3-pyridinyl)carbonyl]-
• (2-Chloro-3-pyridinyl)-1-piperazinylmethanone
• 1-(2-Chloropyridine-3-carbonyl)piperazine