CAS 7291-33-0
:NN-Dimethyltrichloroacetamide
Description:
NN-Dimethyltrichloroacetamide, with the CAS number 7291-33-0, is an organic compound characterized by its amide functional group and the presence of three chlorine atoms attached to the acetamide structure. It is typically a colorless to pale yellow liquid with a distinctive odor. This compound is known for its high polarity and ability to dissolve in various organic solvents, making it useful in chemical synthesis and as a solvent in various applications. Its structure contributes to its reactivity, particularly in nucleophilic substitution reactions, where the chlorine atoms can be replaced by nucleophiles. NN-Dimethyltrichloroacetamide is also recognized for its potential applications in the pharmaceutical and agrochemical industries, where it may serve as an intermediate in the synthesis of more complex molecules. However, due to the presence of chlorine, it is important to handle this compound with care, as it may pose environmental and health risks. Proper safety measures should be observed when working with this substance in laboratory or industrial settings.
Formula:C4H6Cl3NO
InChI:InChI=1/C4H6Cl3NO/c1-8(2)3(9)4(5,6)7/h1-2H3
SMILES:CN(C)C(=O)C(Cl)(Cl)Cl
Synonyms:- 2,2,2-Trichloro-NN-dimethylacetamide
- 2,2,2-trichloro-N,N-dimethylacetamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2,2,2-Trichloro-N,N-dimethylacetamide
CAS:2,2,2-Trichloro-N,N-dimethylacetamide (TCDA) is a compound that can be used as a solvent. TCDA is an amide with two methyl groups and one chlorine atom. It has been shown to have the ability to form lyotropic phases at various temperatures. The various conformations of TCDA are determined by the number of methyl groups and their location on the molecule. This chemical has been found to be able to bind with ethylene and other gases, which allows it to act as a viscosity control agent for liquids in industrial applications. TCDA also has uses in spectroscopic techniques such as nuclear magnetic resonance spectroscopy and mass spectrometry due to its ability to form stable molecules with high molecular weight.Formula:C4H6Cl3NOPurity:One Spot By TlcMolecular weight:190.45 g/mol



