CAS 72912-50-6
:5,8-Difluoro-2,3-dihydro-1,4-benzodioxin
Description:
5,8-Difluoro-2,3-dihydro-1,4-benzodioxin is a chemical compound characterized by its unique bicyclic structure, which consists of a benzene ring fused to a dioxin moiety. The presence of two fluorine atoms at the 5 and 8 positions of the benzodioxin framework significantly influences its chemical properties, including its reactivity and polarity. This compound is typically colorless to pale yellow and may exhibit a range of physical states depending on its purity and environmental conditions. It is important to note that compounds like 5,8-difluoro-2,3-dihydro-1,4-benzodioxin can have applications in various fields, including pharmaceuticals and agrochemicals, due to their potential biological activity. However, specific safety and handling guidelines should be followed, as fluorinated compounds can exhibit unique toxicological profiles. As with many synthetic organic compounds, understanding its behavior in different solvents and under various conditions is crucial for its application in research and industry.
Formula:C8H6F2O2
InChI:InChI=1S/C8H6F2O2/c9-5-1-2-6(10)8-7(5)11-3-4-12-8/h1-2H,3-4H2
InChI key:InChIKey=VNPXSBILOLAXAT-UHFFFAOYSA-N
SMILES:FC1=C2C(=C(F)C=C1)OCCO2
Synonyms:- 1,4-Benzodioxin, 5,8-difluoro-2,3-dihydro-
- 5,8-Difluoro-2,3-Dihydro-1,4-Benzodioxine
- 5,8-Difluoro-2,3-dihydro-1,4-benzodioxin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.