CAS 72917-31-8

1-ethyl-1-methyl-1,1a-dihydrocyclopropa[c][2]benzofuran-3(3aH)-one

Description:

1-Ethyl-1-methyl-1,1a-dihydrocyclopropa[c][2]benzofuran-3(3aH)-one, identified by its CAS number 72917-31-8, is a chemical compound that belongs to the class of benzofurans, which are characterized by a fused benzene and furan ring structure. This specific compound features a cyclopropane moiety, contributing to its unique structural properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of ethyl and methyl groups indicates that it has a branched alkyl structure, which can influence its solubility and reactivity. The compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and pharmacology. Its molecular structure suggests potential for various interactions with biological targets, although specific biological activity would need to be confirmed through empirical studies. As with many organic compounds, it is essential to handle it with care, considering safety data and potential hazards associated with its use.

Formula: C₁₂H₁₄O₂

InChI: InChI=1/C12H14O2/c1-3-11(2)10-12(11)7-5-4-6-8(12)9(13)14-10/h4-8,10H,3H2,1-2H3

SMILES: CCC1(C)C2C31C=CC=CC3C(=O)O2

(Z)-Butylidenephthalide

CAS: 72917-31-8

Formula: C₁₂H₁₂O₂

Purity: %

Molecular weight: 188.2225

Ref: IN-DA005ZO8

(Z)-Butylidenephthalide

CAS: 72917-31-8

(Z)-Butylidenephthalide

Purity: ≥98%

Molecular weight: 188.22g/mol

Ref: 54-BUP03090

(Z)-Butylidenephthalide

CAS: 72917-31-8

(Z)-Butylidenephthalide ((Z)-3-Butylidenephthalide) has antitumor and effects, inhibits tumor growth in gliomas and inhibits R-glucosidase activity.

Formula: C₁₂H₁₂O₂

Purity: 99.72%

Color and Shape: Solid

Molecular weight: 188.22

Ref: TM-TN2326

(Z)-Butylidenephthalide

CAS: 72917-31-8

Formula: C₁₂H₁₂O₂

Purity: 95%~99%

Color and Shape: Oil

Molecular weight: 188.226

Ref: BP-SBP02864

Z-Butylidenephthalide

CAS: 72917-31-8

Z-Butylidenephthalide is a bioactive compound, which is derived from natural sources such as plants in the Apiaceae family, particularly Angelica sinensis, commonly known as Dong Quai. Its mode of action involves interacting with cellular signaling pathways, exhibiting diverse pharmacological effects, including anti-inflammatory, antitumor, and neuroprotective activities.

Formula: C₁₂H₁₂O₂

Purity: Min. 95%

Molecular weight: 188.22 g/mol

Ref: 3D-XCA91731