
CAS 72918-24-2
:5-Nitro-3-furancarboxaldehyde
Description:
5-Nitro-3-furancarboxaldehyde is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing one oxygen atom. This compound features a nitro group (-NO2) and an aldehyde group (-CHO) attached to the furan ring, contributing to its reactivity and potential applications in organic synthesis. It is typically a yellow to brown solid at room temperature and is soluble in organic solvents such as ethanol and acetone. The presence of the nitro group enhances its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions and as a precursor for more complex molecules. Additionally, 5-nitro-3-furancarboxaldehyde can serve as an intermediate in the synthesis of pharmaceuticals and agrochemicals. Safety precautions should be taken when handling this compound, as nitro compounds can be hazardous and may pose environmental risks. Overall, its unique structural features and reactivity make it a valuable compound in synthetic organic chemistry.
Formula:C5H3NO4
InChI:InChI=1S/C5H3NO4/c7-2-4-1-5(6(8)9)10-3-4/h1-3H
InChI key:InChIKey=PCQKABFOXHZRBL-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=CC(C=O)=CO1
Synonyms:- 5-Nitro-3-furancarboxaldehyde
- 3-Furancarboxaldehyde, 5-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

