
CAS 7292-71-9
:amino(3-chlorophenyl)acetic acid
Description:
Amino(3-chlorophenyl)acetic acid, also known by its CAS number 7292-71-9, is an organic compound characterized by the presence of both an amino group and a carboxylic acid group, making it an amino acid derivative. This compound features a 3-chlorophenyl group, which contributes to its unique properties and reactivity. It typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the amino and carboxylic acid functional groups. The chlorophenyl substituent can influence its biological activity and interactions, making it of interest in pharmaceutical and biochemical research. The compound may exhibit various properties, including potential antimicrobial or anti-inflammatory activities, depending on its specific structure and substituents. As with many amino acids, it can participate in peptide bond formation, making it relevant in the study of protein synthesis and biochemistry. Proper handling and storage are essential, as with all chemical substances, to ensure safety and stability.
Formula:C8H8ClNO2
InChI:InChI=1/C8H8ClNO2/c9-6-3-1-2-5(4-6)7(10)8(11)12/h1-4,7H,10H2,(H,11,12)
SMILES:c1cc(cc(c1)Cl)C(C(=O)O)N
Synonyms:- Benzeneacetic acid, alpha-amino-3-chloro-
- Amino-(3-chloro-phenyl)-acetic acid
- (2R)-amino(3-chlorophenyl)ethanoic acid
- (2S)-amino(3-chlorophenyl)ethanoic acid
- m-Chlorophenylglycine
- 2-(3-Chlorophenyl)glycine
- 2-Amino-2-(3-chlorophenyl)acetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Amino-(3-chloro-phenyl)acetic acid
CAS:Formula:C8H8ClNO2Purity:95%Color and Shape:SolidMolecular weight:185.6076Amino-(3-Chloro-Phenyl)-Acetic Acid
CAS:Amino-(3-Chloro-Phenyl)-Acetic AcidPurity:98%Molecular weight:185.61g/molDL-(3-Chlorophenyl)glycine
CAS:Formula:C8H8ClNO2Purity:98%Color and Shape:SolidMolecular weight:185.61Amino(3-chlorophenyl)acetic Acid
CAS:Controlled ProductApplications Amino(3-chlorophenyl)acetic Acid functions as intermediate useful in the preparation of synthetic penicillins, also used in the structure-activity relationship examination of several drugs containing the benzyl moiety, their roles in biochemical and pharmacological processes.
References Hansch, C., et al.: J. Med. Chem., 13, 957 (1970); Holdrege, C. T., et al.: Can. (1975), CA 966853 A2 19750429;Formula:C8H8ClNO2Color and Shape:NeatMolecular weight:185.61



