CAS 7292-81-1

α-Amino-4-carboxybenzeneacetic acid

Description:

α-Amino-4-carboxybenzeneacetic acid, also known as 4-Amino-2-carboxyphenylacetic acid, is an organic compound characterized by its amino and carboxylic acid functional groups attached to a benzene ring. This compound features a phenyl ring with an amino group (-NH2) and two carboxylic acid groups (-COOH) at specific positions, contributing to its acidic and basic properties. It is typically a white to off-white crystalline solid that is soluble in water due to the presence of polar functional groups. The compound is of interest in various fields, including pharmaceuticals and biochemistry, as it may serve as an intermediate in the synthesis of other biologically active molecules. Its structure allows for potential interactions in biological systems, making it relevant in studies related to amino acids and their derivatives. Additionally, the presence of both amino and carboxylic acid groups suggests that it can participate in various chemical reactions, including peptide bond formation and acid-base reactions.

Formula: C₉H₉NO₄

InChI: InChI=1S/C9H9NO4/c10-7(9(13)14)5-1-3-6(4-2-5)8(11)12/h1-4,7H,10H2,(H,11,12)(H,13,14)

InChI key: InChIKey=VTMJKPGFERYGJF-UHFFFAOYSA-N

SMILES: C(C(O)=O)(N)C1=CC=C(C(O)=O)C=C1

Synonyms:

• (RS)-4-CarboxyphenyLglycine
• (S)-4-Carboxyphenylglycine
• Benzeneacetic acid, α-amino-4-carboxy-
• Benzoic Acid, 4-[(Carboxymethyl)Amino]-
• α-Amino-4-carboxybenzeneacetic acid
• 4-[(Carboxymethyl)amino]benzoic acid

4-(Amino(carboxy)methyl)benzoic acid

CAS: 7292-81-1

Formula: C₉H₉NO₄

Purity: 95%

Molecular weight: 195.1721

Ref: IN-DA008QWC

(RS)-4-Carboxyphenylglycine

CAS: 7292-81-1

(RS)-4-Carboxyphenylglycine

Purity: ≥98%

Molecular weight: 195.17g/mol

Ref: 54-BUP13009

(RS)-4-CARBOXYPHENYLGLYCINE

CAS: 7292-81-1

Purity: 95.0%

Molecular weight: 195.174

Ref: 10-F513899

(RS)-4-Carboxyphenylglycine

Controlled Product

CAS: 7292-81-1

Formula: C₉H₉NO₄

Color and Shape: Neat

Molecular weight: 195.172

Ref: TR-C178193

(RS)-4-Carboxyphenylglycine

CAS: 7292-81-1

(RS)-4-Carboxyphenylglycine is a racemic mixture. (S)-4-Carboxyphenylglycine is a selective mGlu1α receptor antagonist.

Formula: C₉H₉NO₄

Purity: 99.04% - >99.99%

Color and Shape: Solid

Molecular weight: 195.17

Ref: TM-T23262