CAS 72920-06-0
:2,4(1H,3H)-Pyrimidinedione, 5-[(dimethylamino)methyl]-, hydrochloride (1:1)
Description:
2,4(1H,3H)-Pyrimidinedione, 5-[(dimethylamino)methyl]-, hydrochloride (1:1), with the CAS number 72920-06-0, is a chemical compound characterized by its pyrimidine core structure, which is a six-membered heterocyclic ring containing two nitrogen atoms at positions 1 and 3. This compound features a dimethylamino group attached to the 5-position of the pyrimidinedione, enhancing its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it suitable for various applications in pharmaceuticals and biochemistry. The presence of the dimethylamino group suggests potential biological activity, possibly influencing its interaction with biological targets. The compound may exhibit properties such as being a weak base due to the nitrogen atoms, and it can participate in hydrogen bonding, which is significant for its solubility and reactivity. Overall, this compound's unique structure and properties make it of interest in medicinal chemistry and related fields.
Formula:C7H11N3O2·ClH
InChI:InChI=1S/C7H11N3O2.ClH/c1-10(2)4-5-3-8-7(12)9-6(5)11;/h3H,4H2,1-2H3,(H2,8,9,11,12);1H
InChI key:InChIKey=ANNAAHLLDGXLOS-UHFFFAOYSA-N
SMILES:C(N(C)C)C=1C(=O)NC(=O)NC1.Cl
Synonyms:- 2,4(1H,3H)-Pyrimidinedione, 5-[(dimethylamino)methyl]-, monohydrochloride
- 2,4(1H,3H)-Pyrimidinedione, 5-[(dimethylamino)methyl]-, hydrochloride (1:1)
- Uracil, 5-(dimethylaminomethyl)-, hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.